About 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid
2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid (PubChem CID 171105319) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid.
Molecular Properties
| Compound Name | 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid |
| PubChem CID | 171105319 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid |
| SMILES | CC1CCCN1C(=O)C(N)C(C)(C)C.O=CO |
| InChI | InChI=1S/C11H22N2O.CH2O2/c1-8-6-5-7-13(8)10(14)9(12)11(2,3)4;2-1-3/h8-9H,5-7,12H2,1-4H3;1H,(H,2,3) |
| InChIKey | ANTRMFOVDRFQDG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid?
The IUPAC name of 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid (CID 171105319) is 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid.
What is the SMILES notation for 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid?
The canonical SMILES for 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid is CC1CCCN1C(=O)C(N)C(C)(C)C.O=CO.
What is the InChIKey of 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid?
The InChIKey is ANTRMFOVDRFQDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O.CH2O2/c1-8-6-5-7-13(8)10(14)9(12)11(2,3)4;2-1-3/h8-9H,5-7,12H2,1-4H3;1H,(H,2,3).
What are the key properties of 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid?
2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid has a molecular weight of 244.33 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;formic acid is sourced from PubChem (CID 171105319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).