C35H42FN3O5SSi — CID 171105716
7-[7-fluoro-3-(methoxymethoxy)-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]-4-[(2R)-2-methylazetidin-1-yl]-2-methylsulfinylpyrano[4,3-d]pyrimidin-5-one (PubChem CID 171105716) has the molecular formula C35H42FN3O5SSi and a molecular weight of 663.89 g/mol. Its IUPAC name is 7-[7-fluoro-3-(methoxymethoxy)-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]-4-[(2R)-2-methylazetidin-1-yl]-2-methylsulfinylpyrano[4,3-d]pyrimidin-5-one.
| Compound Name | 7-[7-fluoro-3-(methoxymethoxy)-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]-4-[(2R)-2-methylazetidin-1-yl]-2-methylsulfinylpyrano[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 171105716 |
| Molecular Formula | C35H42FN3O5SSi |
| Molecular Weight | 663.89 g/mol |
| Exact Mass | 663.26 |
| IUPAC Name | 7-[7-fluoro-3-(methoxymethoxy)-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]-4-[(2R)-2-methylazetidin-1-yl]-2-methylsulfinylpyrano[4,3-d]pyrimidin-5-one |
| SMILES | COCOc1cc(-c2cc3nc(S(C)=O)nc(N4CC[C@H]4C)c3c(=O)o2)c2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c(F)ccc2c1 |
| InChI | InChI=1S/C35H42FN3O5SSi/c1-20(2)46(21(3)4,22(5)6)15-13-26-28(36)11-10-24-16-25(43-19-42-8)17-27(31(24)26)30-18-29-32(34(40)44-30)33(39-14-12-23(39)7)38-35(37-29)45(9)41/h10-11,16-18,20-23H,12,14,19H2,1-9H3/t23-,45?/m1/s1 |
| InChIKey | RBCHGXJCTDQKKH-SEVWOPFUSA-N |
| XLogP | 7.43 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.89 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|