C39H43F2N3O3 — CID 171105921
4-cyclodecyl-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-8-methylpyrano[4,3-d]pyrimidin-5-one (PubChem CID 171105921) has the molecular formula C39H43F2N3O3 and a molecular weight of 639.79 g/mol. Its IUPAC name is 4-cyclodecyl-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-8-methylpyrano[4,3-d]pyrimidin-5-one.
| Compound Name | 4-cyclodecyl-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-8-methylpyrano[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 171105921 |
| Molecular Formula | C39H43F2N3O3 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | 4-cyclodecyl-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-8-methylpyrano[4,3-d]pyrimidin-5-one |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3oc(=O)c4c(C5CCCCCCCCC5)nc(CCC56CCCN5CC(F)C6)nc4c3C)c12 |
| InChI | InChI=1S/C39H43F2N3O3/c1-3-29-31(41)15-14-26-20-28(45)21-30(33(26)29)37-24(2)35-34(38(46)47-37)36(25-12-9-7-5-4-6-8-10-13-25)43-32(42-35)16-18-39-17-11-19-44(39)23-27(40)22-39/h1,14-15,20-21,25,27,45H,4-13,16-19,22-23H2,2H3 |
| InChIKey | WRVIKUDNVBCEPT-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|