C18H21ClN4O3 — CID 171106976
(1R,2S,3R,3aS,6aR)-3-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-5-yl)-6a-(hydroxymethyl)-2,3,3a,4-tetrahydro-1H-pentalene-1,2-diol (PubChem CID 171106976) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is (1R,2S,3R,3aS,6aR)-3-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-5-yl)-6a-(hydroxymethyl)-2,3,3a,4-tetrahydro-1H-pentalene-1,2-diol.
| Compound Name | (1R,2S,3R,3aS,6aR)-3-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-5-yl)-6a-(hydroxymethyl)-2,3,3a,4-tetrahydro-1H-pentalene-1,2-diol |
|---|---|
| PubChem CID | 171106976 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (1R,2S,3R,3aS,6aR)-3-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-5-yl)-6a-(hydroxymethyl)-2,3,3a,4-tetrahydro-1H-pentalene-1,2-diol |
| SMILES | CC1Cc2c(Cl)nc3c(ncn3[C@H]3[C@H](O)[C@H](O)[C@]4(CO)C=CC[C@H]34)c2N1 |
| InChI | InChI=1S/C18H21ClN4O3/c1-8-5-9-11(21-8)12-17(22-16(9)19)23(7-20-12)13-10-3-2-4-18(10,6-24)15(26)14(13)25/h2,4,7-8,10,13-15,21,24-26H,3,5-6H2,1H3/t8?,10-,13-,14+,15+,18+/m1/s1 |
| InChIKey | URQGJTTYJONEFZ-OQFXVHGJSA-N |
| XLogP | 1.27 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|