C20H33ClN4O3 — CID 171107019
8-chloro-11-methyl-5-(3-methylcyclopentyl)-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-10-ol;ethane;propane-2,2-diol (PubChem CID 171107019) has the molecular formula C20H33ClN4O3 and a molecular weight of 412.96 g/mol. Its IUPAC name is 8-chloro-11-methyl-5-(3-methylcyclopentyl)-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-10-ol;ethane;propane-2,2-diol.
| Compound Name | 8-chloro-11-methyl-5-(3-methylcyclopentyl)-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-10-ol;ethane;propane-2,2-diol |
|---|---|
| PubChem CID | 171107019 |
| Molecular Formula | C20H33ClN4O3 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 8-chloro-11-methyl-5-(3-methylcyclopentyl)-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-10-ol;ethane;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.CC1CCC(n2cnc3c4c(c(Cl)nc32)C(O)C(C)N4)C1 |
| InChI | InChI=1S/C15H19ClN4O.C3H8O2.C2H6/c1-7-3-4-9(5-7)20-6-17-12-11-10(13(21)8(2)18-11)14(16)19-15(12)20;1-3(2,4)5;1-2/h6-9,13,18,21H,3-5H2,1-2H3;4-5H,1-2H3;1-2H3 |
| InChIKey | TWOBKEGWIBDWKW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|