C15H19ClN4 — CID 171107023
8-chloro-11-methyl-5-(3-methylcyclopentyl)-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraene (PubChem CID 171107023) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 8-chloro-11-methyl-5-(3-methylcyclopentyl)-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraene.
| Compound Name | 8-chloro-11-methyl-5-(3-methylcyclopentyl)-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraene |
|---|---|
| PubChem CID | 171107023 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 8-chloro-11-methyl-5-(3-methylcyclopentyl)-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraene |
| SMILES | CC1CCC(n2cnc3c4c(c(Cl)nc32)CC(C)N4)C1 |
| InChI | InChI=1S/C15H19ClN4/c1-8-3-4-10(5-8)20-7-17-13-12-11(6-9(2)18-12)14(16)19-15(13)20/h7-10,18H,3-6H2,1-2H3 |
| InChIKey | JEXIJKHRTACVEU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|