C18H26ClF2N5O — CID 171107066
ethane;ethyl 3-[5-chloro-7-(2,2-difluoroethylamino)imidazo[4,5-b]pyridin-3-yl]cyclopentane-1-carboximidate (PubChem CID 171107066) has the molecular formula C18H26ClF2N5O and a molecular weight of 401.89 g/mol. Its IUPAC name is ethane;ethyl 3-[5-chloro-7-(2,2-difluoroethylamino)imidazo[4,5-b]pyridin-3-yl]cyclopentane-1-carboximidate.
| Compound Name | ethane;ethyl 3-[5-chloro-7-(2,2-difluoroethylamino)imidazo[4,5-b]pyridin-3-yl]cyclopentane-1-carboximidate |
|---|---|
| PubChem CID | 171107066 |
| Molecular Formula | C18H26ClF2N5O |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | ethane;ethyl 3-[5-chloro-7-(2,2-difluoroethylamino)imidazo[4,5-b]pyridin-3-yl]cyclopentane-1-carboximidate |
| SMILES | CC.[H]/N=C(\OCC)C1CCC(n2cnc3c(NCC(F)F)cc(Cl)nc32)C1 |
| InChI | InChI=1S/C16H20ClF2N5O.C2H6/c1-2-25-15(20)9-3-4-10(5-9)24-8-22-14-11(21-7-13(18)19)6-12(17)23-16(14)24;1-2/h6,8-10,13,20H,2-5,7H2,1H3,(H,21,23);1-2H3/b20-15-; |
| InChIKey | NNVDCRIIUPDQGR-CRDKNBMZSA-N |
| XLogP | 5.14 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|