C16H17ClN8O — CID 171107081
[8-chloro-5-[(3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-11-yl]methanol (PubChem CID 171107081) has the molecular formula C16H17ClN8O and a molecular weight of 372.82 g/mol. Its IUPAC name is [8-chloro-5-[(3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-11-yl]methanol.
| Compound Name | [8-chloro-5-[(3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-11-yl]methanol |
|---|---|
| PubChem CID | 171107081 |
| Molecular Formula | C16H17ClN8O |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | [8-chloro-5-[(3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-11-yl]methanol |
| SMILES | Cn1nnc([C@@H]2CCC(n3cnc4c5[nH]c(CO)cc5c(Cl)nc43)C2)n1 |
| InChI | InChI=1S/C16H17ClN8O/c1-24-22-15(21-23-24)8-2-3-10(4-8)25-7-18-13-12-11(5-9(6-26)19-12)14(17)20-16(13)25/h5,7-8,10,19,26H,2-4,6H2,1H3/t8-,10?/m1/s1 |
| InChIKey | CPXVQCBDGGOFTB-HNHGDDPOSA-N |
| XLogP | 2.09 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|