C21H37Cl2N3O3 — CID 171107096
[4-(5,7-dichloro-6-methylimidazo[4,5-b]pyridin-3-yl)-2-methylcyclopentyl]methanol;ethane;propane-2,2-diol (PubChem CID 171107096) has the molecular formula C21H37Cl2N3O3 and a molecular weight of 450.45 g/mol. Its IUPAC name is [4-(5,7-dichloro-6-methylimidazo[4,5-b]pyridin-3-yl)-2-methylcyclopentyl]methanol;ethane;propane-2,2-diol.
| Compound Name | [4-(5,7-dichloro-6-methylimidazo[4,5-b]pyridin-3-yl)-2-methylcyclopentyl]methanol;ethane;propane-2,2-diol |
|---|---|
| PubChem CID | 171107096 |
| Molecular Formula | C21H37Cl2N3O3 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [4-(5,7-dichloro-6-methylimidazo[4,5-b]pyridin-3-yl)-2-methylcyclopentyl]methanol;ethane;propane-2,2-diol |
| SMILES | CC.CC.CC(C)(O)O.Cc1c(Cl)nc2c(ncn2C2CC(C)C(CO)C2)c1Cl |
| InChI | InChI=1S/C14H17Cl2N3O.C3H8O2.2C2H6/c1-7-3-10(4-9(7)5-20)19-6-17-12-11(15)8(2)13(16)18-14(12)19;1-3(2,4)5;2*1-2/h6-7,9-10,20H,3-5H2,1-2H3;4-5H,1-2H3;2*1-2H3 |
| InChIKey | QKIYJLPFZHJSBI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|