C15H19ClN8 — CID 171107209
5-chloro-N-ethyl-3-[(1S,3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]imidazo[4,5-b]pyridin-7-amine (PubChem CID 171107209) has the molecular formula C15H19ClN8 and a molecular weight of 346.83 g/mol. Its IUPAC name is 5-chloro-N-ethyl-3-[(1S,3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-N-ethyl-3-[(1S,3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 171107209 |
| Molecular Formula | C15H19ClN8 |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 5-chloro-N-ethyl-3-[(1S,3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]imidazo[4,5-b]pyridin-7-amine |
| SMILES | CCNc1cc(Cl)nc2c1ncn2[C@H]1CC[C@@H](c2nnn(C)n2)C1 |
| InChI | InChI=1S/C15H19ClN8/c1-3-17-11-7-12(16)19-15-13(11)18-8-24(15)10-5-4-9(6-10)14-20-22-23(2)21-14/h7-10H,3-6H2,1-2H3,(H,17,19)/t9-,10+/m1/s1 |
| InChIKey | AMACQFSTFRXPMJ-ZJUUUORDSA-N |
| XLogP | 2.55 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|