C26H24N4O5 — CID 17110723
N-[2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17110723) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is N-[2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17110723 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1ccc2nc(-c3ccc(C)c(NC(=O)c4ccc(N5CCOCC5)c([N+](=O)[O-])c4)c3)oc2c1 |
| InChI | InChI=1S/C26H24N4O5/c1-16-3-7-20-24(13-16)35-26(28-20)19-5-4-17(2)21(14-19)27-25(31)18-6-8-22(23(15-18)30(32)33)29-9-11-34-12-10-29/h3-8,13-15H,9-12H2,1-2H3,(H,27,31) |
| InChIKey | NSOVLDGUIIINRK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|