C25H34O3 — CID 171107406
(1E,3R,8R,9R,10R,14S)-6-benzyl-14-(methoxymethyl)-3,10-dimethyltricyclo[9.3.0.03,7]tetradeca-1,6-diene-8,9-diol (PubChem CID 171107406) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is (1E,3R,8R,9R,10R,14S)-6-benzyl-14-(methoxymethyl)-3,10-dimethyltricyclo[9.3.0.03,7]tetradeca-1,6-diene-8,9-diol.
| Compound Name | (1E,3R,8R,9R,10R,14S)-6-benzyl-14-(methoxymethyl)-3,10-dimethyltricyclo[9.3.0.03,7]tetradeca-1,6-diene-8,9-diol |
|---|---|
| PubChem CID | 171107406 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (1E,3R,8R,9R,10R,14S)-6-benzyl-14-(methoxymethyl)-3,10-dimethyltricyclo[9.3.0.03,7]tetradeca-1,6-diene-8,9-diol |
| SMILES | COC[C@H]1CCC2/C1=C\[C@@]1(C)CCC(Cc3ccccc3)=C1[C@@H](O)[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C25H34O3/c1-16-20-10-9-19(15-28-3)21(20)14-25(2)12-11-18(22(25)24(27)23(16)26)13-17-7-5-4-6-8-17/h4-8,14,16,19-20,23-24,26-27H,9-13,15H2,1-3H3/b21-14-/t16-,19-,20?,23-,24-,25-/m1/s1 |
| InChIKey | PQZGBTWYGSNHEL-IAQGTCKISA-N |
| XLogP | 4.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|