C41H45ClF4N6O4 — CID 171108075
(2,2,2-trifluoroacetyl) 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-[2-(4-piperazin-1-ylpiperidin-1-yl)ethyl]-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylate (PubChem CID 171108075) has the molecular formula C41H45ClF4N6O4 and a molecular weight of 797.29 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-[2-(4-piperazin-1-ylpiperidin-1-yl)ethyl]-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-[2-(4-piperazin-1-ylpiperidin-1-yl)ethyl]-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylate |
|---|---|
| PubChem CID | 171108075 |
| Molecular Formula | C41H45ClF4N6O4 |
| Molecular Weight | 797.29 g/mol |
| Exact Mass | 796.31 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-[2-(4-piperazin-1-ylpiperidin-1-yl)ethyl]-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylate |
| SMILES | Cc1nn(C)c(C)c1-c1c(Cl)ccc2c(CCCOc3cccc4cc(F)ccc34)c(C(=O)OC(=O)C(F)(F)F)n(CCN3CCC(N4CCNCC4)CC3)c12 |
| InChI | InChI=1S/C41H45ClF4N6O4/c1-25-35(26(2)49(3)48-25)36-33(42)12-11-32-31(7-5-23-55-34-8-4-6-27-24-28(43)9-10-30(27)34)38(39(53)56-40(54)41(44,45)46)52(37(32)36)22-21-50-17-13-29(14-18-50)51-19-15-47-16-20-51/h4,6,8-12,24,29,47H,5,7,13-23H2,1-3H3 |
| InChIKey | PKODEZMIPMFIPR-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.29 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|