C15H18N6O — CID 171108232
5-(4-piperidin-4-ylanilino)-1,2,4-triazine-6-carboxamide (PubChem CID 171108232) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 5-(4-piperidin-4-ylanilino)-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-(4-piperidin-4-ylanilino)-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 171108232 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 5-(4-piperidin-4-ylanilino)-1,2,4-triazine-6-carboxamide |
| SMILES | NC(=O)c1nncnc1Nc1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C15H18N6O/c16-14(22)13-15(18-9-19-21-13)20-12-3-1-10(2-4-12)11-5-7-17-8-6-11/h1-4,9,11,17H,5-8H2,(H2,16,22)(H,18,19,20) |
| InChIKey | GJJMQLOGCWXUHE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |