C32H38N4O6 — CID 171108447
methyl (E,6S)-7-[[1-[3-(2-adamantyl)-2-oxopropyl]-2-oxo-3-pyridinyl]amino]-7-oxo-6-(pyridine-3-carbonylamino)hept-2-enoate (PubChem CID 171108447) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is methyl (E,6S)-7-[[1-[3-(2-adamantyl)-2-oxopropyl]-2-oxo-3-pyridinyl]amino]-7-oxo-6-(pyridine-3-carbonylamino)hept-2-enoate.
| Compound Name | methyl (E,6S)-7-[[1-[3-(2-adamantyl)-2-oxopropyl]-2-oxo-3-pyridinyl]amino]-7-oxo-6-(pyridine-3-carbonylamino)hept-2-enoate |
|---|---|
| PubChem CID | 171108447 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | methyl (E,6S)-7-[[1-[3-(2-adamantyl)-2-oxopropyl]-2-oxo-3-pyridinyl]amino]-7-oxo-6-(pyridine-3-carbonylamino)hept-2-enoate |
| SMILES | COC(=O)/C=C/CC[C@H](NC(=O)c1cccnc1)C(=O)Nc1cccn(CC(=O)CC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C32H38N4O6/c1-42-29(38)9-3-2-7-27(34-30(39)22-6-4-10-33-18-22)31(40)35-28-8-5-11-36(32(28)41)19-25(37)17-26-23-13-20-12-21(15-23)16-24(26)14-20/h3-6,8-11,18,20-21,23-24,26-27H,2,7,12-17,19H2,1H3,(H,34,39)(H,35,40)/b9-3+/t20?,21?,23?,24?,26?,27-/m0/s1 |
| InChIKey | NCADENLDVZTFQP-AYMBYUTBSA-N |
| XLogP | 3.52 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|