C17H22N4O4 — CID 171108561
2-[4-[6-[(2,6-dioxopiperidin-3-yl)amino]-3-pyridinyl]piperidin-1-yl]acetic acid (PubChem CID 171108561) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[4-[6-[(2,6-dioxopiperidin-3-yl)amino]-3-pyridinyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[6-[(2,6-dioxopiperidin-3-yl)amino]-3-pyridinyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 171108561 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[4-[6-[(2,6-dioxopiperidin-3-yl)amino]-3-pyridinyl]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(c2ccc(NC3CCC(=O)NC3=O)nc2)CC1 |
| InChI | InChI=1S/C17H22N4O4/c22-15-4-2-13(17(25)20-15)19-14-3-1-12(9-18-14)11-5-7-21(8-6-11)10-16(23)24/h1,3,9,11,13H,2,4-8,10H2,(H,18,19)(H,23,24)(H,20,22,25) |
| InChIKey | HNNZJMXIPXOZLX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|