C37H55NOSn — CID 171108726
3,3-dimethyl-1,1,1-triphenyl-4-(tributylstannylmethoxy)butan-2-amine (PubChem CID 171108726) has the molecular formula C37H55NOSn and a molecular weight of 648.56 g/mol. Its IUPAC name is 3,3-dimethyl-1,1,1-triphenyl-4-(tributylstannylmethoxy)butan-2-amine.
| Compound Name | 3,3-dimethyl-1,1,1-triphenyl-4-(tributylstannylmethoxy)butan-2-amine |
|---|---|
| PubChem CID | 171108726 |
| Molecular Formula | C37H55NOSn |
| Molecular Weight | 648.56 g/mol |
| Exact Mass | 649.33 |
| IUPAC Name | 3,3-dimethyl-1,1,1-triphenyl-4-(tributylstannylmethoxy)butan-2-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)COCC(C)(C)C(N)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28NO.3C4H9.Sn/c1-24(2,19-27-3)23(26)25(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;3*1-3-4-2;/h4-18,23H,3,19,26H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | YRSLZXUDYQQQEB-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.56 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|