C25H35N3O2 — CID 171109056
N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-propan-2-ylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-imidazol-1-ylacetamide (PubChem CID 171109056) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-propan-2-ylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-imidazol-1-ylacetamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-propan-2-ylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-imidazol-1-ylacetamide |
|---|---|
| PubChem CID | 171109056 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-propan-2-ylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-imidazol-1-ylacetamide |
| SMILES | CC(C)c1ccc([C@H]2C[C@@](C)(NC(=O)Cn3ccnc3)[C@@H]3CC[C@@H](C)C[C@H]3O2)cc1 |
| InChI | InChI=1S/C25H35N3O2/c1-17(2)19-6-8-20(9-7-19)23-14-25(4,21-10-5-18(3)13-22(21)30-23)27-24(29)15-28-12-11-26-16-28/h6-9,11-12,16-18,21-23H,5,10,13-15H2,1-4H3,(H,27,29)/t18-,21-,22-,23-,25-/m1/s1 |
| InChIKey | VLNAFLYANVVYKP-BOLWVKMUSA-N |
| XLogP | 4.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |