C15H28S — CID 171109145
(6E)-3,7,11-trimethyldodeca-6,10-diene-1-thiol (PubChem CID 171109145) has the molecular formula C15H28S and a molecular weight of 240.46 g/mol. Its IUPAC name is (6E)-3,7,11-trimethyldodeca-6,10-diene-1-thiol.
| Compound Name | (6E)-3,7,11-trimethyldodeca-6,10-diene-1-thiol |
|---|---|
| PubChem CID | 171109145 |
| Molecular Formula | C15H28S |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (6E)-3,7,11-trimethyldodeca-6,10-diene-1-thiol |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)CCS |
| InChI | InChI=1S/C15H28S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,15-16H,5-6,8,10-12H2,1-4H3/b14-9+ |
| InChIKey | VPEKACVOWWQDHL-NTEUORMPSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|