C15H26S — CID 171109150
(2E,6E)-3,7,11-trimethyldodeca-2,6,11-triene-1-thiol (PubChem CID 171109150) has the molecular formula C15H26S and a molecular weight of 238.44 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyldodeca-2,6,11-triene-1-thiol.
| Compound Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,11-triene-1-thiol |
|---|---|
| PubChem CID | 171109150 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,11-triene-1-thiol |
| SMILES | C=C(C)CCC/C(C)=C/CC/C(C)=C/CS |
| InChI | InChI=1S/C15H26S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h9,11,16H,1,5-8,10,12H2,2-4H3/b14-9+,15-11+ |
| InChIKey | NNQYZQVUPYQEOO-YFVJMOTDSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|