C15H25NS — CID 171109151
(2E,6E,10E)-12-imino-3,7,11-trimethyldodeca-2,6,10-triene-1-thiol (PubChem CID 171109151) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is (2E,6E,10E)-12-imino-3,7,11-trimethyldodeca-2,6,10-triene-1-thiol.
| Compound Name | (2E,6E,10E)-12-imino-3,7,11-trimethyldodeca-2,6,10-triene-1-thiol |
|---|---|
| PubChem CID | 171109151 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (2E,6E,10E)-12-imino-3,7,11-trimethyldodeca-2,6,10-triene-1-thiol |
| SMILES | [H]/N=C/C(C)=C/CC/C(C)=C/CC/C(C)=C/CS |
| InChI | InChI=1S/C15H25NS/c1-13(7-5-9-15(3)12-16)6-4-8-14(2)10-11-17/h6,9-10,12,16-17H,4-5,7-8,11H2,1-3H3/b13-6+,14-10+,15-9+,16-12+ |
| InChIKey | YAWRDQQTPXCTAY-XDBHZUOHSA-N |
| XLogP | 4.97 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|