C16H19BFNO6 — CID 171109694
2-[1-fluoro-2-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171109694) has the molecular formula C16H19BFNO6 and a molecular weight of 351.14 g/mol. Its IUPAC name is 2-[1-fluoro-2-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-fluoro-2-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171109694 |
| Molecular Formula | C16H19BFNO6 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[1-fluoro-2-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=Cc2cc3c(cc2[N+](=O)[O-])OCCO3)OC1(C)C |
| InChI | InChI=1S/C16H19BFNO6/c1-15(2)16(3,4)25-17(24-15)14(18)8-10-7-12-13(23-6-5-22-12)9-11(10)19(20)21/h7-9H,5-6H2,1-4H3 |
| InChIKey | RDPKAZATTNJMES-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|