C16H18BBrFNO2 — CID 171109872
6-bromo-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-indole (PubChem CID 171109872) has the molecular formula C16H18BBrFNO2 and a molecular weight of 366.04 g/mol. Its IUPAC name is 6-bromo-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-indole.
| Compound Name | 6-bromo-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-indole |
|---|---|
| PubChem CID | 171109872 |
| Molecular Formula | C16H18BBrFNO2 |
| Molecular Weight | 366.04 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 6-bromo-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-indole |
| SMILES | CC1(C)OB(C(F)=Cc2c[nH]c3cc(Br)ccc23)OC1(C)C |
| InChI | InChI=1S/C16H18BBrFNO2/c1-15(2)16(3,4)22-17(21-15)14(19)7-10-9-20-13-8-11(18)5-6-12(10)13/h5-9,20H,1-4H3 |
| InChIKey | QIJPDDCTEJSNMI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.04 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|