C15H28BFO3 — CID 171109914
2-(1-fluoro-6-methoxy-5,5-dimethylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171109914) has the molecular formula C15H28BFO3 and a molecular weight of 286.20 g/mol. Its IUPAC name is 2-(1-fluoro-6-methoxy-5,5-dimethylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1-fluoro-6-methoxy-5,5-dimethylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171109914 |
| Molecular Formula | C15H28BFO3 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 2-(1-fluoro-6-methoxy-5,5-dimethylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COCC(C)(C)CCC=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H28BFO3/c1-13(2,11-18-7)10-8-9-12(17)16-19-14(3,4)15(5,6)20-16/h9H,8,10-11H2,1-7H3 |
| InChIKey | UNKQZRYMJUSCSM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|