C16H17BBrFN2O2 — CID 171109981
6-bromo-2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,8-naphthyridine (PubChem CID 171109981) has the molecular formula C16H17BBrFN2O2 and a molecular weight of 379.04 g/mol. Its IUPAC name is 6-bromo-2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,8-naphthyridine.
| Compound Name | 6-bromo-2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,8-naphthyridine |
|---|---|
| PubChem CID | 171109981 |
| Molecular Formula | C16H17BBrFN2O2 |
| Molecular Weight | 379.04 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 6-bromo-2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,8-naphthyridine |
| SMILES | CC1(C)OB(C(F)=Cc2ccc3cc(Br)cnc3n2)OC1(C)C |
| InChI | InChI=1S/C16H17BBrFN2O2/c1-15(2)16(3,4)23-17(22-15)13(19)8-12-6-5-10-7-11(18)9-20-14(10)21-12/h5-9H,1-4H3 |
| InChIKey | SEVKYOAUHPHRDN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.04 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|