C15H21BBrFN2O2 — CID 171110216
3-bromo-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-N,N-dimethylpyridin-2-amine (PubChem CID 171110216) has the molecular formula C15H21BBrFN2O2 and a molecular weight of 371.06 g/mol. Its IUPAC name is 3-bromo-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-N,N-dimethylpyridin-2-amine.
| Compound Name | 3-bromo-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 171110216 |
| Molecular Formula | C15H21BBrFN2O2 |
| Molecular Weight | 371.06 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-bromo-5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ncc(C=C(F)B2OC(C)(C)C(C)(C)O2)cc1Br |
| InChI | InChI=1S/C15H21BBrFN2O2/c1-14(2)15(3,4)22-16(21-14)12(18)8-10-7-11(17)13(19-9-10)20(5)6/h7-9H,1-6H3 |
| InChIKey | ZFCHZVMSQUAXHG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.06 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|