C12H18BFN2O2 — CID 171110261
2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-methylimidazole (PubChem CID 171110261) has the molecular formula C12H18BFN2O2 and a molecular weight of 252.10 g/mol. Its IUPAC name is 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-methylimidazole.
| Compound Name | 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-methylimidazole |
|---|---|
| PubChem CID | 171110261 |
| Molecular Formula | C12H18BFN2O2 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-methylimidazole |
| SMILES | Cn1ccnc1C=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H18BFN2O2/c1-11(2)12(3,4)18-13(17-11)9(14)8-10-15-6-7-16(10)5/h6-8H,1-5H3 |
| InChIKey | GUOHASPQYKOILF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|