C14H22BFN2O2 — CID 171110263
2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-propan-2-ylimidazole (PubChem CID 171110263) has the molecular formula C14H22BFN2O2 and a molecular weight of 280.15 g/mol. Its IUPAC name is 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-propan-2-ylimidazole.
| Compound Name | 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-propan-2-ylimidazole |
|---|---|
| PubChem CID | 171110263 |
| Molecular Formula | C14H22BFN2O2 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-propan-2-ylimidazole |
| SMILES | CC(C)n1ccnc1C=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H22BFN2O2/c1-10(2)18-8-7-17-12(18)9-11(16)15-19-13(3,4)14(5,6)20-15/h7-10H,1-6H3 |
| InChIKey | GPPVRLBXFQSQEU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|