C20H26BFN2O2 — CID 171110302
4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3,5-dimethyl-1-(2-methylphenyl)pyrazole (PubChem CID 171110302) has the molecular formula C20H26BFN2O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3,5-dimethyl-1-(2-methylphenyl)pyrazole.
| Compound Name | 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3,5-dimethyl-1-(2-methylphenyl)pyrazole |
|---|---|
| PubChem CID | 171110302 |
| Molecular Formula | C20H26BFN2O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3,5-dimethyl-1-(2-methylphenyl)pyrazole |
| SMILES | Cc1ccccc1-n1nc(C)c(C=C(F)B2OC(C)(C)C(C)(C)O2)c1C |
| InChI | InChI=1S/C20H26BFN2O2/c1-13-10-8-9-11-17(13)24-15(3)16(14(2)23-24)12-18(22)21-25-19(4,5)20(6,7)26-21/h8-12H,1-7H3 |
| InChIKey | SQAISLLZDHMCAN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|