C19H23BF2N2O2 — CID 171110305
1-(2-fluorophenyl)-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3,5-dimethylpyrazole (PubChem CID 171110305) has the molecular formula C19H23BF2N2O2 and a molecular weight of 360.21 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3,5-dimethylpyrazole.
| Compound Name | 1-(2-fluorophenyl)-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 171110305 |
| Molecular Formula | C19H23BF2N2O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-3,5-dimethylpyrazole |
| SMILES | Cc1nn(-c2ccccc2F)c(C)c1C=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H23BF2N2O2/c1-12-14(11-17(22)20-25-18(3,4)19(5,6)26-20)13(2)24(23-12)16-10-8-7-9-15(16)21/h7-11H,1-6H3 |
| InChIKey | QVJMWTPMDYQPMX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|