C17H22BFO3 — CID 171110430
2-[1-fluoro-2-(3-prop-2-enoxyphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110430) has the molecular formula C17H22BFO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 2-[1-fluoro-2-(3-prop-2-enoxyphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-fluoro-2-(3-prop-2-enoxyphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110430 |
| Molecular Formula | C17H22BFO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-[1-fluoro-2-(3-prop-2-enoxyphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CCOc1cccc(C=C(F)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C17H22BFO3/c1-6-10-20-14-9-7-8-13(11-14)12-15(19)18-21-16(2,3)17(4,5)22-18/h6-9,11-12H,1,10H2,2-5H3 |
| InChIKey | BNRLOJYVLREKMD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|