C21H29BFNO4 — CID 171110490
tert-butyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 171110490) has the molecular formula C21H29BFNO4 and a molecular weight of 389.28 g/mol. Its IUPAC name is tert-butyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 171110490 |
| Molecular Formula | C21H29BFNO4 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | tert-butyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2CC1C=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H29BFNO4/c1-19(2,3)26-18(25)24-15(12-14-10-8-9-11-16(14)24)13-17(23)22-27-20(4,5)21(6,7)28-22/h8-11,13,15H,12H2,1-7H3 |
| InChIKey | AEIFAMWXMKZDKE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|