C17H26BFN4O2 — CID 171110586
1-[1-(cyclopropylmethyl)azetidin-3-yl]-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazole (PubChem CID 171110586) has the molecular formula C17H26BFN4O2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 1-[1-(cyclopropylmethyl)azetidin-3-yl]-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazole.
| Compound Name | 1-[1-(cyclopropylmethyl)azetidin-3-yl]-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazole |
|---|---|
| PubChem CID | 171110586 |
| Molecular Formula | C17H26BFN4O2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-[1-(cyclopropylmethyl)azetidin-3-yl]-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazole |
| SMILES | CC1(C)OB(C(F)=Cc2cn(C3CN(CC4CC4)C3)nn2)OC1(C)C |
| InChI | InChI=1S/C17H26BFN4O2/c1-16(2)17(3,4)25-18(24-16)15(19)7-13-9-23(21-20-13)14-10-22(11-14)8-12-5-6-12/h7,9,12,14H,5-6,8,10-11H2,1-4H3 |
| InChIKey | VISNABZCGFONNE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|