C17H28BFN4O2 — CID 171110603
4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-[1-(2-methylpropyl)azetidin-3-yl]triazole (PubChem CID 171110603) has the molecular formula C17H28BFN4O2 and a molecular weight of 350.25 g/mol. Its IUPAC name is 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-[1-(2-methylpropyl)azetidin-3-yl]triazole.
| Compound Name | 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-[1-(2-methylpropyl)azetidin-3-yl]triazole |
|---|---|
| PubChem CID | 171110603 |
| Molecular Formula | C17H28BFN4O2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-[1-(2-methylpropyl)azetidin-3-yl]triazole |
| SMILES | CC(C)CN1CC(n2cc(C=C(F)B3OC(C)(C)C(C)(C)O3)nn2)C1 |
| InChI | InChI=1S/C17H28BFN4O2/c1-12(2)8-22-10-14(11-22)23-9-13(20-21-23)7-15(19)18-24-16(3,4)17(5,6)25-18/h7,9,12,14H,8,10-11H2,1-6H3 |
| InChIKey | SBMNASOENQRANF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|