C16H19BFN3O2 — CID 171111469
4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyrazol-3-yl]pyridine (PubChem CID 171111469) has the molecular formula C16H19BFN3O2 and a molecular weight of 315.16 g/mol. Its IUPAC name is 4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyrazol-3-yl]pyridine.
| Compound Name | 4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 171111469 |
| Molecular Formula | C16H19BFN3O2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyrazol-3-yl]pyridine |
| SMILES | CC1(C)OB(C(F)=Cc2cc(-c3ccncc3)n[nH]2)OC1(C)C |
| InChI | InChI=1S/C16H19BFN3O2/c1-15(2)16(3,4)23-17(22-15)14(18)10-12-9-13(21-20-12)11-5-7-19-8-6-11/h5-10H,1-4H3,(H,20,21) |
| InChIKey | IMWRCWPJGJAXLH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|