C18H20BFN2O2S — CID 171111507
5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynyl-3-thiophen-3-ylpyrazole (PubChem CID 171111507) has the molecular formula C18H20BFN2O2S and a molecular weight of 358.25 g/mol. Its IUPAC name is 5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynyl-3-thiophen-3-ylpyrazole.
| Compound Name | 5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynyl-3-thiophen-3-ylpyrazole |
|---|---|
| PubChem CID | 171111507 |
| Molecular Formula | C18H20BFN2O2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynyl-3-thiophen-3-ylpyrazole |
| SMILES | C#CCn1nc(-c2ccsc2)cc1C=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H20BFN2O2S/c1-6-8-22-14(10-15(21-22)13-7-9-25-12-13)11-16(20)19-23-17(2,3)18(4,5)24-19/h1,7,9-12H,8H2,2-5H3 |
| InChIKey | HOXXOAKCZXQVMC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|