C18H22BFN2O2 — CID 171111720
4-[3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-5-phenyl-1H-pyrazole (PubChem CID 171111720) has the molecular formula C18H22BFN2O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 4-[3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-5-phenyl-1H-pyrazole.
| Compound Name | 4-[3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-5-phenyl-1H-pyrazole |
|---|---|
| PubChem CID | 171111720 |
| Molecular Formula | C18H22BFN2O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4-[3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-5-phenyl-1H-pyrazole |
| SMILES | CC1(C)OB(C(F)=CCc2cn[nH]c2-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C18H22BFN2O2/c1-17(2)18(3,4)24-19(23-17)15(20)11-10-14-12-21-22-16(14)13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3,(H,21,22) |
| InChIKey | QULIUKFDXKPLOO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|