C17H21BFN3O2 — CID 171111761
3-[1-[3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]pyrazol-4-yl]pyridine (PubChem CID 171111761) has the molecular formula C17H21BFN3O2 and a molecular weight of 329.18 g/mol. Its IUPAC name is 3-[1-[3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]pyrazol-4-yl]pyridine.
| Compound Name | 3-[1-[3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]pyrazol-4-yl]pyridine |
|---|---|
| PubChem CID | 171111761 |
| Molecular Formula | C17H21BFN3O2 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[1-[3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]pyrazol-4-yl]pyridine |
| SMILES | CC1(C)OB(C(F)=CCn2cc(-c3cccnc3)cn2)OC1(C)C |
| InChI | InChI=1S/C17H21BFN3O2/c1-16(2)17(3,4)24-18(23-16)15(19)7-9-22-12-14(11-21-22)13-6-5-8-20-10-13/h5-8,10-12H,9H2,1-4H3 |
| InChIKey | PRFHWGLRZFQTIR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|