C18H23BFNO3 — CID 171111943
1-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]pyrrolidin-2-one (PubChem CID 171111943) has the molecular formula C18H23BFNO3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 171111943 |
| Molecular Formula | C18H23BFNO3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-[4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]pyrrolidin-2-one |
| SMILES | CC1(C)OB(C(F)=Cc2ccc(N3CCCC3=O)cc2)OC1(C)C |
| InChI | InChI=1S/C18H23BFNO3/c1-17(2)18(3,4)24-19(23-17)15(20)12-13-7-9-14(10-8-13)21-11-5-6-16(21)22/h7-10,12H,5-6,11H2,1-4H3 |
| InChIKey | XAXKLMBOKGFEJY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|