C18H20BFN2O2 — CID 171111997
2-[2-fluoro-1-pyridin-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine (PubChem CID 171111997) has the molecular formula C18H20BFN2O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-[2-fluoro-1-pyridin-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine.
| Compound Name | 2-[2-fluoro-1-pyridin-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
|---|---|
| PubChem CID | 171111997 |
| Molecular Formula | C18H20BFN2O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-[2-fluoro-1-pyridin-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
| SMILES | CC1(C)OB(C(F)=C(c2ccccn2)c2ccccn2)OC1(C)C |
| InChI | InChI=1S/C18H20BFN2O2/c1-17(2)18(3,4)24-19(23-17)16(20)15(13-9-5-7-11-21-13)14-10-6-8-12-22-14/h5-12H,1-4H3 |
| InChIKey | WMAGGEPQDPCBHH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|