C16H19BFNO4 — CID 171112164
3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-1-(hydroxymethyl)indol-2-one (PubChem CID 171112164) has the molecular formula C16H19BFNO4 and a molecular weight of 319.14 g/mol. Its IUPAC name is 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-1-(hydroxymethyl)indol-2-one.
| Compound Name | 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-1-(hydroxymethyl)indol-2-one |
|---|---|
| PubChem CID | 171112164 |
| Molecular Formula | C16H19BFNO4 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-1-(hydroxymethyl)indol-2-one |
| SMILES | CC1(C)OB(C(F)=C2C(=O)N(CO)c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C16H19BFNO4/c1-15(2)16(3,4)23-17(22-15)13(18)12-10-7-5-6-8-11(10)19(9-20)14(12)21/h5-8,20H,9H2,1-4H3 |
| InChIKey | SJVGRXHAIZSTAE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|