C18H22BF2N3O2S — CID 171112249
3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-N-(4-fluorophenyl)-1,2,4-thiadiazol-5-amine (PubChem CID 171112249) has the molecular formula C18H22BF2N3O2S and a molecular weight of 393.27 g/mol. Its IUPAC name is 3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-N-(4-fluorophenyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-N-(4-fluorophenyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 171112249 |
| Molecular Formula | C18H22BF2N3O2S |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-N-(4-fluorophenyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(Cc1nsc(Nc2ccc(F)cc2)n1)=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H22BF2N3O2S/c1-11(15(21)19-25-17(2,3)18(4,5)26-19)10-14-23-16(27-24-14)22-13-8-6-12(20)7-9-13/h6-9H,10H2,1-5H3,(H,22,23,24) |
| InChIKey | NCXFUBWQENPBBT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|