C17H21BFN3O4S — CID 171112367
N-[3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1,2,4-thiadiazol-5-yl]furan-2-carboxamide (PubChem CID 171112367) has the molecular formula C17H21BFN3O4S and a molecular weight of 393.25 g/mol. Its IUPAC name is N-[3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1,2,4-thiadiazol-5-yl]furan-2-carboxamide.
| Compound Name | N-[3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1,2,4-thiadiazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 171112367 |
| Molecular Formula | C17H21BFN3O4S |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1,2,4-thiadiazol-5-yl]furan-2-carboxamide |
| SMILES | CC(Cc1nsc(NC(=O)c2ccco2)n1)=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H21BFN3O4S/c1-10(13(19)18-25-16(2,3)17(4,5)26-18)9-12-20-15(27-22-12)21-14(23)11-7-6-8-24-11/h6-8H,9H2,1-5H3,(H,20,21,22,23) |
| InChIKey | BKBVBLAFLONLBP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|