C19H36BFN2O2 — CID 171112516
[1-[2-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-3,3-dimethylbutyl]piperidin-4-yl]methanamine (PubChem CID 171112516) has the molecular formula C19H36BFN2O2 and a molecular weight of 354.32 g/mol. Its IUPAC name is [1-[2-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-3,3-dimethylbutyl]piperidin-4-yl]methanamine.
| Compound Name | [1-[2-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-3,3-dimethylbutyl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 171112516 |
| Molecular Formula | C19H36BFN2O2 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | [1-[2-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-3,3-dimethylbutyl]piperidin-4-yl]methanamine |
| SMILES | CC(C)(C)C(CN1CCC(CN)CC1)=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H36BFN2O2/c1-17(2,3)15(13-23-10-8-14(12-22)9-11-23)16(21)20-24-18(4,5)19(6,7)25-20/h14H,8-13,22H2,1-7H3 |
| InChIKey | MASPJPFMMYRMHI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|