C17H28BFO2 — CID 171112648
2-[(3-cyclohexylcyclobutylidene)-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171112648) has the molecular formula C17H28BFO2 and a molecular weight of 294.22 g/mol. Its IUPAC name is 2-[(3-cyclohexylcyclobutylidene)-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(3-cyclohexylcyclobutylidene)-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171112648 |
| Molecular Formula | C17H28BFO2 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-[(3-cyclohexylcyclobutylidene)-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=C2CC(C3CCCCC3)C2)OC1(C)C |
| InChI | InChI=1S/C17H28BFO2/c1-16(2)17(3,4)21-18(20-16)15(19)14-10-13(11-14)12-8-6-5-7-9-12/h12-13H,5-11H2,1-4H3/b15-14- |
| InChIKey | GJVIHGVSIOSKQH-PFONDFGASA-N |
| XLogP | 4.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|