C16H25BF4O2 — CID 171112739
2-[fluoro-[4-(3,3,3-trifluoropropyl)cyclohexylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171112739) has the molecular formula C16H25BF4O2 and a molecular weight of 336.18 g/mol. Its IUPAC name is 2-[fluoro-[4-(3,3,3-trifluoropropyl)cyclohexylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[fluoro-[4-(3,3,3-trifluoropropyl)cyclohexylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171112739 |
| Molecular Formula | C16H25BF4O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-[fluoro-[4-(3,3,3-trifluoropropyl)cyclohexylidene]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=C2CCC(CCC(F)(F)F)CC2)OC1(C)C |
| InChI | InChI=1S/C16H25BF4O2/c1-14(2)15(3,4)23-17(22-14)13(18)12-7-5-11(6-8-12)9-10-16(19,20)21/h11H,5-10H2,1-4H3/b13-12- |
| InChIKey | UISANWREKKKHIF-SEYXRHQNSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|