C15H22BF3O2 — CID 171113323
2-[(5,5-difluoro-2-bicyclo[4.2.0]octanylidene)-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171113323) has the molecular formula C15H22BF3O2 and a molecular weight of 302.14 g/mol. Its IUPAC name is 2-[(5,5-difluoro-2-bicyclo[4.2.0]octanylidene)-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(5,5-difluoro-2-bicyclo[4.2.0]octanylidene)-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171113323 |
| Molecular Formula | C15H22BF3O2 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-[(5,5-difluoro-2-bicyclo[4.2.0]octanylidene)-fluoromethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=C2CCC(F)(F)C3CCC23)OC1(C)C |
| InChI | InChI=1S/C15H22BF3O2/c1-13(2)14(3,4)21-16(20-13)12(17)10-7-8-15(18,19)11-6-5-9(10)11/h9,11H,5-8H2,1-4H3 |
| InChIKey | ONCQPOORNXNBEQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|