C19H30BFO3 — CID 171113382
3-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]adamantan-1-ol (PubChem CID 171113382) has the molecular formula C19H30BFO3 and a molecular weight of 336.26 g/mol. Its IUPAC name is 3-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]adamantan-1-ol.
| Compound Name | 3-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]adamantan-1-ol |
|---|---|
| PubChem CID | 171113382 |
| Molecular Formula | C19H30BFO3 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-[1-fluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]adamantan-1-ol |
| SMILES | CC(=C(F)B1OC(C)(C)C(C)(C)O1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C19H30BFO3/c1-12(15(21)20-23-16(2,3)17(4,5)24-20)18-7-13-6-14(8-18)10-19(22,9-13)11-18/h13-14,22H,6-11H2,1-5H3 |
| InChIKey | OQMXMAKWWWBURP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|