C15H23BFN3O2S — CID 171113820
3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-4-methyl-5-methylsulfanyl-1,2,4-triazole (PubChem CID 171113820) has the molecular formula C15H23BFN3O2S and a molecular weight of 339.25 g/mol. Its IUPAC name is 3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-4-methyl-5-methylsulfanyl-1,2,4-triazole.
| Compound Name | 3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-4-methyl-5-methylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 171113820 |
| Molecular Formula | C15H23BFN3O2S |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-4-methyl-5-methylsulfanyl-1,2,4-triazole |
| SMILES | CSc1nnc(C2CC(=C(F)B3OC(C)(C)C(C)(C)O3)C2)n1C |
| InChI | InChI=1S/C15H23BFN3O2S/c1-14(2)15(3,4)22-16(21-14)11(17)9-7-10(8-9)12-18-19-13(23-6)20(12)5/h10H,7-8H2,1-6H3/b11-9- |
| InChIKey | MOAHMVGELRRFOL-LUAWRHEFSA-N |
| XLogP | 3.27 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|