C22H29BFNO6 — CID 171113834
3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 171113834) has the molecular formula C22H29BFNO6 and a molecular weight of 433.29 g/mol. Its IUPAC name is 3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 171113834 |
| Molecular Formula | C22H29BFNO6 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 3-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclobutyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CC1(C)OB(C(F)=C2CC(CC(NC(=O)OCc3ccccc3)C(=O)O)C2)OC1(C)C |
| InChI | InChI=1S/C22H29BFNO6/c1-21(2)22(3,4)31-23(30-21)18(24)16-10-15(11-16)12-17(19(26)27)25-20(28)29-13-14-8-6-5-7-9-14/h5-9,15,17H,10-13H2,1-4H3,(H,25,28)(H,26,27)/b18-16- |
| InChIKey | INYCUDUTNQXBSW-VLGSPTGOSA-N |
| XLogP | 4.02 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|